![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[SND]](/icons/sound2.gif) | Stilgoe & Skellern - Rambling On...-Y7Vc0lOV6Iw.m4a | 2014-03-02 23:18 | 67M | |
| 1-01 Are You Gonna Stop The White Xm.mp3 | 2012-12-24 10:53 | 8.8M | |
| Nature Trail to Hell.mp3 | 2012-02-23 21:05 | 5.3M | |
| 10 Garden Gnome.mp3 | 2012-02-23 21:02 | 5.0M | |
| Girlshapedlovedrug.mp3 | 2011-11-24 20:54 | 5.9M | |
| 01 Alice's Restaurant Massacree.mp3 | 2011-11-24 20:46 | 34M | |
| John Finnemore's Souvenir Programme Episode 4 09-10-11.mp3 | 2011-10-25 12:52 | 28M | |
| 08 '76 aka The Slow Train.mp3 | 2011-09-13 13:20 | 5.2M | |
| 11 Alone.mp3 | 2011-09-08 20:25 | 4.9M | |
![[DIR]](/icons/folder.gif) | Zombies/ | 2011-07-21 20:29 | - | |
| 2-08 The Pop Singers Fear Of The Pol.mp3 | 2011-07-06 10:35 | 4.0M | |
| Ieva's polka.mp3 | 2011-01-04 14:17 | 3.2M | |
| 100314-Bohemian-Rhapsody.mp3 | 2010-03-12 05:10 | 6.1M | |
| Blockheads/ | 2010-01-07 14:44 | - | |
| 12 - Chemical Workers Song.mp3 | 2009-12-16 22:24 | 8.0M | |
| SmellsLikeNirvana.mp3 | 2009-10-19 14:47 | 6.8M | |
| HardwareStore.mp3 | 2009-10-19 14:44 | 4.1M | |
| Polka.mp3 | 2009-10-19 14:44 | 4.7M | |
| 19 Knock, Knock - Recitative and Cho.mp3 | 2009-08-18 10:37 | 7.3M | |
| The_Flatpack_Bride_of_Possibilities.mp3 | 2009-08-04 14:05 | 6.1M | |
| 05 Jiggery Pokery.mp3 | 2009-07-29 08:35 | 5.3M | |
| chemical_song.mp3 | 2009-07-17 11:54 | 1.4M | |
| The_Man_Who_Was_Eaten_By_A_Pie.mp3 | 2009-07-16 14:19 | 6.2M | |
| 3-18 Labio-Dental Fricative.mp3 | 2009-07-14 11:38 | 3.9M | |
| 01 Creep.mp3 | 2009-07-08 09:37 | 1.1M | |
| 07 Phantom Of The Opera Song.mp3 | 2009-07-07 16:19 | 2.4M | |
| Duke_Special_Everybody_Wants_A_Little_Something_3_Tainted_Love.mp3 | 2009-06-12 12:13 | 8.4M | |
| Another_Day.mp3 | 2009-05-17 15:17 | 4.3M | |
| DYAQ.mp3 | 2009-05-05 11:25 | 6.8M | |
| Throw your arms around me.mp3 | 2009-04-19 21:38 | 2.9M | |
| 16 One Day in October _ Take a Letter Miss Jones.mp3 | 2008-12-19 12:44 | 3.9M | |
| Les Jours Tristes.mp3 | 2008-12-16 18:29 | 3.1M | |
| Sin_To_tell_a_lie.mp3 | 2008-12-05 15:25 | 3.7M | |
| 04 The Carol of the Olde Ones.mp3 | 2008-12-02 15:24 | 1.2M | |
| Get me to a monastary.mp3 | 2008-11-27 15:58 | 4.1M | |
| The Dead Only Quickly Decay.mp3 | 2008-11-27 14:35 | 1.2M | |
| 11 Sandy Bull - Carmina Burana Fanta.mp3 | 2008-11-03 11:03 | 4.2M | |
| nessyinthezoo.mp3 | 2008-10-30 13:35 | 2.4M | |
| MCR_SQ_Black_Parade.mp3 | 2008-10-29 12:25 | 7.0M | |
| MCR_SQ_Eminem_Lose_Yourself.mp3 | 2008-10-29 12:22 | 6.0M | |
| MCR_SQ_Teenagers.mp3 | 2008-10-29 12:21 | 3.8M | |
| 04 You Sound Like Louis Burdett.mp3 | 2008-10-20 11:01 | 5.4M | |
| 03 Love Is Everywhere.mp3 | 2008-10-20 11:00 | 4.9M | |
| Robot_Ponies.mp3 | 2008-10-17 13:22 | 5.7M | |
| 01 Who_s On First.mp3 | 2008-10-08 09:05 | 5.2M | |
| Help.mp3 | 2008-09-25 14:56 | 3.1M | |
| piratetraining.mp3 | 2008-09-19 12:14 | 2.3M | |
| Allan Sherman - Return To Camp Granada.mp3 | 2008-09-16 17:01 | 2.6M | |
| All mine (Portishead cover).mp3 | 2008-09-10 12:26 | 3.7M | |
| ISIRTA - stuff that gibbon.mp3 | 2008-08-28 15:15 | 4.1M | |
| 03 Will You Follow Me_.mp3 | 2008-08-22 11:24 | 7.0M | |
| 18 Kiss Me, Son Of God.mp3 | 2008-08-22 11:21 | 1.7M | |
| diff/ | 2008-08-22 09:03 | - | |
| Kick_In_The_Ass.mp3 | 2008-08-20 15:29 | 3.7M | |
| 07 Beer.mp3 | 2008-08-15 13:06 | 4.9M | |
| Tea.mp3 | 2008-07-30 09:51 | 3.4M | |
| ggg.mp3 | 2008-07-22 13:02 | 3.3M | |
| March of the Sinister Ducks.mp3 | 2008-07-15 16:08 | 3.2M | |
| 080525-Bicycle-Race .mp3 | 2008-05-28 10:28 | 2.5M | |
| 03 Far Away.mp3 | 2008-05-28 10:24 | 7.2M | |
| 14 Blood.mp3 | 2008-05-20 16:24 | 2.0M | |
| gummi_bears_acapella.mp3 | 2008-05-16 11:02 | 1.1M | |
| 09 The Easter Song.mp3 | 2008-02-14 11:06 | 1.5M | |
| 14 Creep.mp3 | 2008-02-14 10:07 | 4.0M | |
| British People.mp3 | 2008-02-04 11:01 | 3.0M | |
| 04 Why Does The Sun Shine_.mp3 | 2008-02-04 11:00 | 1.0M | |
| 16 Boys Of Bedlam.mp3 | 2008-01-18 15:58 | 2.7M | |
| merrychristmas.mp3 | 2007-12-22 14:55 | 4.0M | |
| 03 Mahna, Mahna.mp3 | 2007-12-22 13:55 | 4.0M | |
| curiositysphere.mp3 | 2007-10-23 15:41 | 19K | |
| smax/ | 2007-09-05 10:56 | - | |
| GP05-TheCaptainsWifesLament.mp3 | 2007-08-11 12:08 | 3.3M | |
| CounttoTen.mp3 | 2007-08-11 12:07 | 5.1M | |
| 18 Keep Your Jesus Off My Penis.mp3 | 2007-07-23 11:14 | 5.6M | |
| 09 First of May.mp3 | 2007-04-26 21:03 | 5.7M | |
| 05 Birdhouse In Your Soul.mp3 | 2007-04-21 11:48 | 2.9M | |
| Drunken Sailor.mp3 | 2007-04-21 11:46 | 2.3M | |
| daas.mp3 | 2007-04-21 11:35 | 1.5M | |
| Necrophilia.mp3 | 2007-04-21 11:35 | 2.3M | |
| Come Closer.mp3 | 2007-04-21 11:35 | 5.9M | |
| Divine Comedy - The Dead Only Quickl.mp3 | 2007-04-21 11:35 | 1.2M | |
| 08 Song 2 (Blur).mp3 | 2007-04-21 10:48 | 2.2M | |
| 04 Mah na' mah na' (Album Version).mp3 | 2007-04-21 10:47 | 1.8M | |
| Leva's polka.mp3 | 2007-04-21 10:38 | 3.2M | |
| boothby/ | 2007-04-04 13:17 | - | |
| 05 Happiness Writes White.mp3 | 2007-02-28 12:29 | 3.9M | |
| deniro.mp3 | 2007-02-16 12:31 | 3.0M | |
| Karma Police (Radiohead).mp3 | 2006-11-17 12:47 | 4.0M | |
| emo.mp3 | 2006-11-17 12:46 | 7.1M | |
| 05 No One Knows (Queens Of The Stone Age Cover) 1.mp3 | 2006-11-17 12:45 | 4.2M | |
| The-Fear.mp3 | 2006-11-09 14:13 | 7.4M | |
| noone-knows.mp3 | 2006-11-06 10:10 | 6.4M | |
| 02 Bank Job.mp3 | 2006-09-15 10:11 | 6.2M | |
| ferret_song.mp3 | 2006-09-05 15:17 | 3.9M | |
| ISIRTA-Eurovision-Pun-Contest.mp3 | 2003-03-03 11:40 | 811K | |
|
|---|